C12H22N4O2 — CID 127345397
4-ethyl-N-(1-methyl-2-oxopyrrolidin-3-yl)piperazine-1-carboxamide (PubChem CID 127345397) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-ethyl-N-(1-methyl-2-oxopyrrolidin-3-yl)piperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-(1-methyl-2-oxopyrrolidin-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 127345397 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-ethyl-N-(1-methyl-2-oxopyrrolidin-3-yl)piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC2CCN(C)C2=O)CC1 |
| InChI | InChI=1S/C12H22N4O2/c1-3-15-6-8-16(9-7-15)12(18)13-10-4-5-14(2)11(10)17/h10H,3-9H2,1-2H3,(H,13,18) |
| InChIKey | ZRUBDFVPUCAFRW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |