C17H25ClN4O3S — CID 4628080
N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-4-ethylpiperazine-1-carboxamide (PubChem CID 4628080) has the molecular formula C17H25ClN4O3S and a molecular weight of 400.93 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-4-ethylpiperazine-1-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-4-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 4628080 |
| Molecular Formula | C17H25ClN4O3S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]-4-ethylpiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NC2CCCN2S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H25ClN4O3S/c1-2-20-10-12-21(13-11-20)17(23)19-16-4-3-9-22(16)26(24,25)15-7-5-14(18)6-8-15/h5-8,16H,2-4,9-13H2,1H3,(H,19,23) |
| InChIKey | GLZINICFUJEKJF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |