C12H8Cl2N6S — CID 12736063
6-(3,4-dichlorophenyl)sulfanylpteridine-2,4-diamine (PubChem CID 12736063) has the molecular formula C12H8Cl2N6S and a molecular weight of 339.21 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)sulfanylpteridine-2,4-diamine.
| Compound Name | 6-(3,4-dichlorophenyl)sulfanylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 12736063 |
| Molecular Formula | C12H8Cl2N6S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 6-(3,4-dichlorophenyl)sulfanylpteridine-2,4-diamine |
| SMILES | Nc1nc(N)c2nc(Sc3ccc(Cl)c(Cl)c3)cnc2n1 |
| InChI | InChI=1S/C12H8Cl2N6S/c13-6-2-1-5(3-7(6)14)21-8-4-17-11-9(18-8)10(15)19-12(16)20-11/h1-4H,(H4,15,16,17,19,20) |
| InChIKey | CWVKQVHFVAOIIB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |