C12H16O3 — CID 12736093
ethyl 1-methyl-3-oxo-2,4,5,6-tetrahydro-1H-pentalene-2-carboxylate (PubChem CID 12736093) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is ethyl 1-methyl-3-oxo-2,4,5,6-tetrahydro-1H-pentalene-2-carboxylate.
| Compound Name | ethyl 1-methyl-3-oxo-2,4,5,6-tetrahydro-1H-pentalene-2-carboxylate |
|---|---|
| PubChem CID | 12736093 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethyl 1-methyl-3-oxo-2,4,5,6-tetrahydro-1H-pentalene-2-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C2=C(CCC2)C1C |
| InChI | InChI=1S/C12H16O3/c1-3-15-12(14)10-7(2)8-5-4-6-9(8)11(10)13/h7,10H,3-6H2,1-2H3 |
| InChIKey | HPNGQWYFGGRHLH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|