C8H15F3N2O2S — CID 127364964
N,N-dimethyl-4-(trifluoromethyl)piperidine-1-sulfonamide (PubChem CID 127364964) has the molecular formula C8H15F3N2O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is N,N-dimethyl-4-(trifluoromethyl)piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(trifluoromethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 127364964 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N,N-dimethyl-4-(trifluoromethyl)piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N2O2S/c1-12(2)16(14,15)13-5-3-7(4-6-13)8(9,10)11/h7H,3-6H2,1-2H3 |
| InChIKey | UBQNJBVLORUYIB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |