C18H28N4O4 — CID 127389894
1-N-cyclopentyl-3-N-(2,5-dioxopyrrolidin-3-yl)-3-N-ethylpiperidine-1,3-dicarboxamide (PubChem CID 127389894) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-N-cyclopentyl-3-N-(2,5-dioxopyrrolidin-3-yl)-3-N-ethylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-cyclopentyl-3-N-(2,5-dioxopyrrolidin-3-yl)-3-N-ethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 127389894 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 1-N-cyclopentyl-3-N-(2,5-dioxopyrrolidin-3-yl)-3-N-ethylpiperidine-1,3-dicarboxamide |
| SMILES | CCN(C(=O)C1CCCN(C(=O)NC2CCCC2)C1)C1CC(=O)NC1=O |
| InChI | InChI=1S/C18H28N4O4/c1-2-22(14-10-15(23)20-16(14)24)17(25)12-6-5-9-21(11-12)18(26)19-13-7-3-4-8-13/h12-14H,2-11H2,1H3,(H,19,26)(H,20,23,24) |
| InChIKey | RMXMABQCNHELAB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|