C9H14N2O2S2 — CID 127408516
2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole (PubChem CID 127408516) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole.
| Compound Name | 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 127408516 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C9H14N2O2S2/c1-7-9(14-8(2)10-7)15(12,13)11-5-3-4-6-11/h3-6H2,1-2H3 |
| InChIKey | KZAKAMCZPKRYTE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |