About 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole
2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole (PubChem CID 127408516) has the molecular formula C9H14N2O2S2
and a molecular weight of 246.36 g/mol. Its IUPAC name is 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole |
| PubChem CID | 127408516 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C9H14N2O2S2/c1-7-9(14-8(2)10-7)15(12,13)11-5-3-4-6-11/h3-6H2,1-2H3 |
| InChIKey | KZAKAMCZPKRYTE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole?
The IUPAC name of 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole (CID 127408516) is 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole.
What is the SMILES notation for 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole?
The canonical SMILES for 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole is Cc1nc(C)c(S(=O)(=O)N2CCCC2)s1.
What is the InChIKey of 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole?
The InChIKey is KZAKAMCZPKRYTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S2/c1-7-9(14-8(2)10-7)15(12,13)11-5-3-4-6-11/h3-6H2,1-2H3.
What are the key properties of 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole?
2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole has a molecular weight of 246.36 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-pyrrolidin-1-ylsulfonyl-1,3-thiazole is sourced from PubChem (CID 127408516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).