C8H11ClN2O3S2 — CID 43456060
4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]morpholine (PubChem CID 43456060) has the molecular formula C8H11ClN2O3S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]morpholine.
| Compound Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]morpholine |
|---|---|
| PubChem CID | 43456060 |
| Molecular Formula | C8H11ClN2O3S2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 4-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonyl]morpholine |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C8H11ClN2O3S2/c1-6-7(15-8(9)10-6)16(12,13)11-2-4-14-5-3-11/h2-5H2,1H3 |
| InChIKey | VHMMRMYAORZXSN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |