About 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile
6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile (PubChem CID 12741231) has the molecular formula C15H7N5O2
and a molecular weight of 289.25 g/mol. Its IUPAC name is 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile.
Molecular Properties
| Compound Name | 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile |
| PubChem CID | 12741231 |
| Molecular Formula | C15H7N5O2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile |
| SMILES | N#CC1=C(Nc2ccc3ncccc3c2C#N)C(=O)NC1=O |
| InChI | InChI=1S/C15H7N5O2/c16-6-9-8-2-1-5-18-11(8)3-4-12(9)19-13-10(7-17)14(21)20-15(13)22/h1-5H,(H2,19,20,21,22) |
| InChIKey | MRUKIJFXLGBMCT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile?
The IUPAC name of 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile (CID 12741231) is 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile.
What is the SMILES notation for 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile?
The canonical SMILES for 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile is N#CC1=C(Nc2ccc3ncccc3c2C#N)C(=O)NC1=O.
What is the InChIKey of 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile?
The InChIKey is MRUKIJFXLGBMCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7N5O2/c16-6-9-8-2-1-5-18-11(8)3-4-12(9)19-13-10(7-17)14(21)20-15(13)22/h1-5H,(H2,19,20,21,22).
What are the key properties of 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile?
6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile has a molecular weight of 289.25 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-cyano-2,5-dioxopyrrol-3-yl)amino]quinoline-5-carbonitrile is sourced from PubChem (CID 12741231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).