C11H19NO4S2 — CID 127442065
4-cyclopropylsulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide (PubChem CID 127442065) has the molecular formula C11H19NO4S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide.
| Compound Name | 4-cyclopropylsulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 127442065 |
| Molecular Formula | C11H19NO4S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-cyclopropylsulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)C2CC2)C2CCCCC21 |
| InChI | InChI=1S/C11H19NO4S2/c13-17(14)8-7-12(18(15,16)9-5-6-9)10-3-1-2-4-11(10)17/h9-11H,1-8H2 |
| InChIKey | MEVMIKNMSDOQAX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |