C13H24FNO2S — CID 122133978
4-(5-fluoropentyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide (PubChem CID 122133978) has the molecular formula C13H24FNO2S and a molecular weight of 277.40 g/mol. Its IUPAC name is 4-(5-fluoropentyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide.
| Compound Name | 4-(5-fluoropentyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
|---|---|
| PubChem CID | 122133978 |
| Molecular Formula | C13H24FNO2S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-(5-fluoropentyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazine 1,1-dioxide |
| SMILES | O=S1(=O)CCN(CCCCCF)C2CCCCC21 |
| InChI | InChI=1S/C13H24FNO2S/c14-8-4-1-5-9-15-10-11-18(16,17)13-7-3-2-6-12(13)15/h12-13H,1-11H2 |
| InChIKey | RAKJKEQZVUNBHC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|