C10H19NO2S — CID 58283203
4-cyclohexyl-1,4-thiazinane 1,1-dioxide (PubChem CID 58283203) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is 4-cyclohexyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-cyclohexyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 58283203 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-cyclohexyl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C10H19NO2S/c12-14(13)8-6-11(7-9-14)10-4-2-1-3-5-10/h10H,1-9H2 |
| InChIKey | WWHSNJUUJDRPCG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |