C9H18ClNO2S — CID 45148608
3-piperidin-1-ylthiolane 1,1-dioxide;hydrochloride (PubChem CID 45148608) has the molecular formula C9H18ClNO2S and a molecular weight of 239.77 g/mol. Its IUPAC name is 3-piperidin-1-ylthiolane 1,1-dioxide;hydrochloride.
| Compound Name | 3-piperidin-1-ylthiolane 1,1-dioxide;hydrochloride |
|---|---|
| PubChem CID | 45148608 |
| Molecular Formula | C9H18ClNO2S |
| Molecular Weight | 239.77 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-piperidin-1-ylthiolane 1,1-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C9H17NO2S.ClH/c11-13(12)7-4-9(8-13)10-5-2-1-3-6-10;/h9H,1-8H2;1H |
| InChIKey | QGCUMCYUYRYKQC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.77 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |