C10H19NO4S2 — CID 22693957
3-(2-methylpiperidin-1-yl)sulfonylthiolane 1,1-dioxide (PubChem CID 22693957) has the molecular formula C10H19NO4S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)sulfonylthiolane 1,1-dioxide.
| Compound Name | 3-(2-methylpiperidin-1-yl)sulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 22693957 |
| Molecular Formula | C10H19NO4S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)sulfonylthiolane 1,1-dioxide |
| SMILES | CC1CCCCN1S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO4S2/c1-9-4-2-3-6-11(9)17(14,15)10-5-7-16(12,13)8-10/h9-10H,2-8H2,1H3 |
| InChIKey | DZOCBKRQOKTLLY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |