C9H17NO2S — CID 92856900
(2R,3S)-2-methyl-3-piperidin-1-ylthietane 1,1-dioxide (PubChem CID 92856900) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is (2R,3S)-2-methyl-3-piperidin-1-ylthietane 1,1-dioxide.
| Compound Name | (2R,3S)-2-methyl-3-piperidin-1-ylthietane 1,1-dioxide |
|---|---|
| PubChem CID | 92856900 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (2R,3S)-2-methyl-3-piperidin-1-ylthietane 1,1-dioxide |
| SMILES | C[C@@H]1[C@@H](N2CCCCC2)CS1(=O)=O |
| InChI | InChI=1S/C9H17NO2S/c1-8-9(7-13(8,11)12)10-5-3-2-4-6-10/h8-9H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | FWCBOAIJDYTVGL-BDAKNGLRSA-N |
| XLogP | 0.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |