C14H25F2NO2S — CID 167027086
4-[(1S)-3,3-difluorocyclohexyl]sulfonyl-1-propan-2-ylpiperidine (PubChem CID 167027086) has the molecular formula C14H25F2NO2S and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[(1S)-3,3-difluorocyclohexyl]sulfonyl-1-propan-2-ylpiperidine.
| Compound Name | 4-[(1S)-3,3-difluorocyclohexyl]sulfonyl-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 167027086 |
| Molecular Formula | C14H25F2NO2S |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-[(1S)-3,3-difluorocyclohexyl]sulfonyl-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCC(S(=O)(=O)[C@H]2CCCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C14H25F2NO2S/c1-11(2)17-8-5-12(6-9-17)20(18,19)13-4-3-7-14(15,16)10-13/h11-13H,3-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | LVDNKTUCRZWYIB-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |