C8H14F3NO2S — CID 121183069
4-methylsulfonyl-1-(2,2,2-trifluoroethyl)piperidine (PubChem CID 121183069) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is 4-methylsulfonyl-1-(2,2,2-trifluoroethyl)piperidine.
| Compound Name | 4-methylsulfonyl-1-(2,2,2-trifluoroethyl)piperidine |
|---|---|
| PubChem CID | 121183069 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-methylsulfonyl-1-(2,2,2-trifluoroethyl)piperidine |
| SMILES | CS(=O)(=O)C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3NO2S/c1-15(13,14)7-2-4-12(5-3-7)6-8(9,10)11/h7H,2-6H2,1H3 |
| InChIKey | DMWFAGARJUZLPE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |