C9H15F4NO2S — CID 126638201
1-(3,3,4,4-tetrafluorobutylsulfonyl)piperidine (PubChem CID 126638201) has the molecular formula C9H15F4NO2S and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-(3,3,4,4-tetrafluorobutylsulfonyl)piperidine.
| Compound Name | 1-(3,3,4,4-tetrafluorobutylsulfonyl)piperidine |
|---|---|
| PubChem CID | 126638201 |
| Molecular Formula | C9H15F4NO2S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-(3,3,4,4-tetrafluorobutylsulfonyl)piperidine |
| SMILES | O=S(=O)(CCC(F)(F)C(F)F)N1CCCCC1 |
| InChI | InChI=1S/C9H15F4NO2S/c10-8(11)9(12,13)4-7-17(15,16)14-5-2-1-3-6-14/h8H,1-7H2 |
| InChIKey | AZBGWPOKPINXQI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|