C9H11F9N2O4S2 — CID 58031149
1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonyl-N-(trifluoromethyl)propane-1-sulfonamide (PubChem CID 58031149) has the molecular formula C9H11F9N2O4S2 and a molecular weight of 446.31 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonyl-N-(trifluoromethyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonyl-N-(trifluoromethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 58031149 |
| Molecular Formula | C9H11F9N2O4S2 |
| Molecular Weight | 446.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-piperidin-1-ylsulfonyl-N-(trifluoromethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(NC(F)(F)F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H11F9N2O4S2/c10-6(11,7(12,13)25(21,22)19-9(16,17)18)8(14,15)26(23,24)20-4-2-1-3-5-20/h19H,1-5H2 |
| InChIKey | SJIJOXLCNXHTNW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|