C8H15F2NO2S — CID 121184672
4,4-difluoro-1-propan-2-ylsulfonylpiperidine (PubChem CID 121184672) has the molecular formula C8H15F2NO2S and a molecular weight of 227.28 g/mol. Its IUPAC name is 4,4-difluoro-1-propan-2-ylsulfonylpiperidine.
| Compound Name | 4,4-difluoro-1-propan-2-ylsulfonylpiperidine |
|---|---|
| PubChem CID | 121184672 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4,4-difluoro-1-propan-2-ylsulfonylpiperidine |
| SMILES | CC(C)S(=O)(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H15F2NO2S/c1-7(2)14(12,13)11-5-3-8(9,10)4-6-11/h7H,3-6H2,1-2H3 |
| InChIKey | UHTSILUPLYSHLK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |