C13H14F13NO2S — CID 101424712
1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]piperidine (PubChem CID 101424712) has the molecular formula C13H14F13NO2S and a molecular weight of 495.30 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]piperidine.
| Compound Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]piperidine |
|---|---|
| PubChem CID | 101424712 |
| Molecular Formula | C13H14F13NO2S |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)ethyl]piperidine |
| SMILES | O=S(=O)(CCN1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F13NO2S/c14-8(15,10(18,19)12(22,23)24)9(16,17)11(20,21)13(25,26)30(28,29)7-6-27-4-2-1-3-5-27/h1-7H2 |
| InChIKey | GRKWZEIWAQVNPW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|