C13H14F13NOS — CID 15947736
1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]piperidine (PubChem CID 15947736) has the molecular formula C13H14F13NOS and a molecular weight of 479.30 g/mol. Its IUPAC name is 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]piperidine.
| Compound Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]piperidine |
|---|---|
| PubChem CID | 15947736 |
| Molecular Formula | C13H14F13NOS |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 1-[2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfinyl)ethyl]piperidine |
| SMILES | O=S(CCN1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F13NOS/c14-8(15,10(18,19)12(22,23)24)9(16,17)11(20,21)13(25,26)29(28)7-6-27-4-2-1-3-5-27/h1-7H2 |
| InChIKey | WYVCMOGAOBPUIC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|