C17H16ClNOS — CID 1274537
(2S)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1,3-thiazolidin-4-one (PubChem CID 1274537) has the molecular formula C17H16ClNOS and a molecular weight of 317.84 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1274537 |
| Molecular Formula | C17H16ClNOS |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-3-(4-ethylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCc1ccc(N2C(=O)CS[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H16ClNOS/c1-2-12-3-9-15(10-4-12)19-16(20)11-21-17(19)13-5-7-14(18)8-6-13/h3-10,17H,2,11H2,1H3/t17-/m0/s1 |
| InChIKey | HLDVQPPMWKOUCS-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |