About 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine
4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 127470255) has the molecular formula C14H19N5OS
and a molecular weight of 305.41 g/mol. Its IUPAC name is 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
| PubChem CID | 127470255 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cn1cc(C2(C)CN(c3nc(C4CC4)ns3)CCO2)cn1 |
| InChI | InChI=1S/C14H19N5OS/c1-14(11-7-15-18(2)8-11)9-19(5-6-20-14)13-16-12(17-21-13)10-3-4-10/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | LMKCPBSVEYCKIS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The IUPAC name of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine (CID 127470255) is 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine.
What is the SMILES notation for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The canonical SMILES for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine is Cn1cc(C2(C)CN(c3nc(C4CC4)ns3)CCO2)cn1.
What is the InChIKey of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
The InChIKey is LMKCPBSVEYCKIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5OS/c1-14(11-7-15-18(2)8-11)9-19(5-6-20-14)13-16-12(17-21-13)10-3-4-10/h7-8,10H,3-6,9H2,1-2H3.
What are the key properties of 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine?
4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine has a molecular weight of 305.41 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-2-methyl-2-(1-methylpyrazol-4-yl)morpholine is sourced from PubChem (CID 127470255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).