C14H18N6O2 — CID 133365217
6-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]pyrazine-2-carboxamide (PubChem CID 133365217) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 6-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]pyrazine-2-carboxamide.
| Compound Name | 6-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133365217 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 6-[2-methyl-2-(1-methylpyrazol-4-yl)morpholin-4-yl]pyrazine-2-carboxamide |
| SMILES | Cn1cc(C2(C)CN(c3cncc(C(N)=O)n3)CCO2)cn1 |
| InChI | InChI=1S/C14H18N6O2/c1-14(10-5-17-19(2)8-10)9-20(3-4-22-14)12-7-16-6-11(18-12)13(15)21/h5-8H,3-4,9H2,1-2H3,(H2,15,21) |
| InChIKey | IAYUGYGARBBFQM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |