C20H22ClN5O2 — CID 133365129
4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine (PubChem CID 133365129) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine.
| Compound Name | 4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
|---|---|
| PubChem CID | 133365129 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[6-[(3-chlorophenyl)methoxy]pyrazin-2-yl]-2-methyl-2-(1-methylpyrazol-4-yl)morpholine |
| SMILES | Cn1cc(C2(C)CN(c3cncc(OCc4cccc(Cl)c4)n3)CCO2)cn1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-20(16-9-23-25(2)12-16)14-26(6-7-28-20)18-10-22-11-19(24-18)27-13-15-4-3-5-17(21)8-15/h3-5,8-12H,6-7,13-14H2,1-2H3 |
| InChIKey | VKHILKCKPCXISW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |