C15H13F3N4OS — CID 127499950
N-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxamide (PubChem CID 127499950) has the molecular formula C15H13F3N4OS and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxamide.
| Compound Name | N-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxamide |
|---|---|
| PubChem CID | 127499950 |
| Molecular Formula | C15H13F3N4OS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-[5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-yl]-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene-11-carboxamide |
| SMILES | O=C(Nc1nnc(CC(F)(F)F)s1)N1C2CCC1c1ccccc12 |
| InChI | InChI=1S/C15H13F3N4OS/c16-15(17,18)7-12-20-21-13(24-12)19-14(23)22-10-5-6-11(22)9-4-2-1-3-8(9)10/h1-4,10-11H,5-7H2,(H,19,21,23) |
| InChIKey | IOKFKMVLRFBPJZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |