C11H15I — CID 12752699
1-butyl-6-iodocyclohepta-1,3,5-triene (PubChem CID 12752699) has the molecular formula C11H15I and a molecular weight of 274.14 g/mol. Its IUPAC name is 1-butyl-6-iodocyclohepta-1,3,5-triene.
| Compound Name | 1-butyl-6-iodocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 12752699 |
| Molecular Formula | C11H15I |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-butyl-6-iodocyclohepta-1,3,5-triene |
| SMILES | CCCCC1=CC=CC=C(I)C1 |
| InChI | InChI=1S/C11H15I/c1-2-3-6-10-7-4-5-8-11(12)9-10/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | CDUUDDHQYJGHHZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|