C10H11I — CID 13382533
1-iodo-6-prop-2-enylcyclohepta-1,3,5-triene (PubChem CID 13382533) has the molecular formula C10H11I and a molecular weight of 258.10 g/mol. Its IUPAC name is 1-iodo-6-prop-2-enylcyclohepta-1,3,5-triene.
| Compound Name | 1-iodo-6-prop-2-enylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 13382533 |
| Molecular Formula | C10H11I |
| Molecular Weight | 258.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 1-iodo-6-prop-2-enylcyclohepta-1,3,5-triene |
| SMILES | C=CCC1=CC=CC=C(I)C1 |
| InChI | InChI=1S/C10H11I/c1-2-5-9-6-3-4-7-10(11)8-9/h2-4,6-7H,1,5,8H2 |
| InChIKey | FZQDCNARCZJRQT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.10 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|