C9H14FN — CID 12754568
2-butyl-6-fluoro-2,5-dihydropyridine (PubChem CID 12754568) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-butyl-6-fluoro-2,5-dihydropyridine.
| Compound Name | 2-butyl-6-fluoro-2,5-dihydropyridine |
|---|---|
| PubChem CID | 12754568 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-butyl-6-fluoro-2,5-dihydropyridine |
| SMILES | CCCCC1C=CCC(F)=N1 |
| InChI | InChI=1S/C9H14FN/c1-2-3-5-8-6-4-7-9(10)11-8/h4,6,8H,2-3,5,7H2,1H3 |
| InChIKey | OWHFLLQARNKBAU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|