About 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine
2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine (PubChem CID 12754574) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine |
| PubChem CID | 12754574 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine |
| SMILES | CCCCC1C=CC(C(C)C)C(F)=N1 |
| InChI | InChI=1S/C12H20FN/c1-4-5-6-10-7-8-11(9(2)3)12(13)14-10/h7-11H,4-6H2,1-3H3 |
| InChIKey | RKEQOFTTWNZGJU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine?
The IUPAC name of 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine (CID 12754574) is 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine.
What is the SMILES notation for 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine?
The canonical SMILES for 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine is CCCCC1C=CC(C(C)C)C(F)=N1.
What is the InChIKey of 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine?
The InChIKey is RKEQOFTTWNZGJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20FN/c1-4-5-6-10-7-8-11(9(2)3)12(13)14-10/h7-11H,4-6H2,1-3H3.
What are the key properties of 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine?
2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine has a molecular weight of 197.30 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-fluoro-5-propan-2-yl-2,5-dihydropyridine is sourced from PubChem (CID 12754574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).