C7H14O2 — CID 12755464
(3R,4R)-4-methoxyhex-5-en-3-ol (PubChem CID 12755464) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (3R,4R)-4-methoxyhex-5-en-3-ol.
| Compound Name | (3R,4R)-4-methoxyhex-5-en-3-ol |
|---|---|
| PubChem CID | 12755464 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (3R,4R)-4-methoxyhex-5-en-3-ol |
| SMILES | C=C[C@@H](OC)[C@H](O)CC |
| InChI | InChI=1S/C7H14O2/c1-4-6(8)7(5-2)9-3/h5-8H,2,4H2,1,3H3/t6-,7-/m1/s1 |
| InChIKey | BBPYKUCDWIFQBG-RNFRBKRXSA-N |
| XLogP | 0.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|