C13H24O2 — CID 12757741
(E)-10-methoxy-7,7-dimethyldec-9-en-5-one (PubChem CID 12757741) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (E)-10-methoxy-7,7-dimethyldec-9-en-5-one.
| Compound Name | (E)-10-methoxy-7,7-dimethyldec-9-en-5-one |
|---|---|
| PubChem CID | 12757741 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (E)-10-methoxy-7,7-dimethyldec-9-en-5-one |
| SMILES | CCCCC(=O)CC(C)(C)C/C=C/OC |
| InChI | InChI=1S/C13H24O2/c1-5-6-8-12(14)11-13(2,3)9-7-10-15-4/h7,10H,5-6,8-9,11H2,1-4H3/b10-7+ |
| InChIKey | UXDXCGPABMVXLT-JXMROGBWSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|