C12H18O2 — CID 5375341
(5E)-5-[(Isopropenyloxy)methylene]-3,3-dimethylcyclohexanone (PubChem CID 5375341) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (5E)-3,3-dimethyl-5-(prop-1-en-2-yloxymethylidene)cyclohexan-1-one.
| Compound Name | (5E)-5-[(Isopropenyloxy)methylene]-3,3-dimethylcyclohexanone |
|---|---|
| PubChem CID | 5375341 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (5E)-3,3-dimethyl-5-(prop-1-en-2-yloxymethylidene)cyclohexan-1-one |
| SMILES | CC(=C)O/C=C\1/CC(=O)CC(C1)(C)C |
| InChI | InChI=1S/C12H18O2/c1-9(2)14-8-10-5-11(13)7-12(3,4)6-10/h8H,1,5-7H2,2-4H3/b10-8- |
| InChIKey | NSIXOIIYLVNYLK-NTMALXAHSA-N |
| XLogP | 2.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 285 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|