C14H11N3O — CID 12759619
3-(4-methoxyphenyl)-1,2,4-benzotriazine (PubChem CID 12759619) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2,4-benzotriazine.
| Compound Name | 3-(4-methoxyphenyl)-1,2,4-benzotriazine |
|---|---|
| PubChem CID | 12759619 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2,4-benzotriazine |
| SMILES | COc1ccc(-c2nnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C14H11N3O/c1-18-11-8-6-10(7-9-11)14-15-12-4-2-3-5-13(12)16-17-14/h2-9H,1H3 |
| InChIKey | DRVAQMPQCZLYGO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |