C18H18ClN3OS — CID 127602951
6-chloro-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)quinoline-3-carbonitrile (PubChem CID 127602951) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 6-chloro-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)quinoline-3-carbonitrile.
| Compound Name | 6-chloro-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 127602951 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-chloro-4-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2ccc(Cl)cc2c1NC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C18H18ClN3OS/c19-13-1-2-16-15(7-13)17(12(9-20)10-21-16)22-14-3-5-23-18(8-14)4-6-24-11-18/h1-2,7,10,14H,3-6,8,11H2,(H,21,22) |
| InChIKey | OGGZEUZKCOIUTL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |