C27H18N2O3 — CID 1276042
4-[(15R,19S)-1-acetyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzonitrile (PubChem CID 1276042) has the molecular formula C27H18N2O3 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-[(15R,19S)-1-acetyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzonitrile.
| Compound Name | 4-[(15R,19S)-1-acetyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzonitrile |
|---|---|
| PubChem CID | 1276042 |
| Molecular Formula | C27H18N2O3 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[(15R,19S)-1-acetyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzonitrile |
| SMILES | CC(=O)C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc(C#N)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C27H18N2O3/c1-15(30)27-20-8-4-2-6-18(20)22(19-7-3-5-9-21(19)27)23-24(27)26(32)29(25(23)31)17-12-10-16(14-28)11-13-17/h2-13,22-24H,1H3/t22?,23-,24-,27?/m0/s1 |
| InChIKey | TXIYWLPFZMIPQM-ZCOIRKDISA-N |
| XLogP | 3.70 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|