C22H33NO3 — CID 127628139
1-(4-tert-butylphenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]cyclohexane-1-carboxamide (PubChem CID 127628139) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127628139 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-[[3-(hydroxymethyl)oxetan-3-yl]methyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2(C(=O)NCC3(CO)COC3)CCCCC2)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-20(2,3)17-7-9-18(10-8-17)22(11-5-4-6-12-22)19(25)23-13-21(14-24)15-26-16-21/h7-10,24H,4-6,11-16H2,1-3H3,(H,23,25) |
| InChIKey | FZXWMXXICLTVNH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |