C20H31NO2 — CID 112818275
1-(4-tert-butylphenyl)-N-(1-hydroxypropan-2-yl)cyclohexane-1-carboxamide (PubChem CID 112818275) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-N-(1-hydroxypropan-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-(4-tert-butylphenyl)-N-(1-hydroxypropan-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 112818275 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 1-(4-tert-butylphenyl)-N-(1-hydroxypropan-2-yl)cyclohexane-1-carboxamide |
| SMILES | CC(CO)NC(=O)C1(c2ccc(C(C)(C)C)cc2)CCCCC1 |
| InChI | InChI=1S/C20H31NO2/c1-15(14-22)21-18(23)20(12-6-5-7-13-20)17-10-8-16(9-11-17)19(2,3)4/h8-11,15,22H,5-7,12-14H2,1-4H3,(H,21,23) |
| InChIKey | UMSKFZYQBABWIA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |