C21H28N4O3 — CID 127706362
N-[4-(azepane-1-carbonyl)phenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 127706362) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[4-(azepane-1-carbonyl)phenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[4-(azepane-1-carbonyl)phenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 127706362 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-[4-(azepane-1-carbonyl)phenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCCCC2)cc1)N1CCN2C(=O)CCC2C1 |
| InChI | InChI=1S/C21H28N4O3/c26-19-10-9-18-15-24(13-14-25(18)19)21(28)22-17-7-5-16(6-8-17)20(27)23-11-3-1-2-4-12-23/h5-8,18H,1-4,9-15H2,(H,22,28) |
| InChIKey | JXZBOCDCKVXUFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |