C17H24N4O5S — CID 127707313
N-[4-(dimethylsulfamoyl)-3-methoxyphenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 127707313) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)-3-methoxyphenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[4-(dimethylsulfamoyl)-3-methoxyphenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 127707313 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)-3-methoxyphenyl]-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN3C(=O)CCC3C2)ccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H24N4O5S/c1-19(2)27(24,25)15-6-4-12(10-14(15)26-3)18-17(23)20-8-9-21-13(11-20)5-7-16(21)22/h4,6,10,13H,5,7-9,11H2,1-3H3,(H,18,23) |
| InChIKey | MZQXAOHGKOTCRW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |