C13H17N5O4S — CID 72926629
N-(3-cyano-4-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide (PubChem CID 72926629) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(3-cyano-4-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide.
| Compound Name | N-(3-cyano-4-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 72926629 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(3-cyano-4-methoxyphenyl)-4-sulfamoylpiperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(S(N)(=O)=O)CC2)cc1C#N |
| InChI | InChI=1S/C13H17N5O4S/c1-22-12-3-2-11(8-10(12)9-14)16-13(19)17-4-6-18(7-5-17)23(15,20)21/h2-3,8H,4-7H2,1H3,(H,16,19)(H2,15,20,21) |
| InChIKey | YBPILCYFLUKMPC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |