C15H20N4O5 — CID 74247912
methyl 4-[(3-carbamoyl-4-methoxyphenyl)carbamoyl]piperazine-1-carboxylate (PubChem CID 74247912) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is methyl 4-[(3-carbamoyl-4-methoxyphenyl)carbamoyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[(3-carbamoyl-4-methoxyphenyl)carbamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74247912 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | methyl 4-[(3-carbamoyl-4-methoxyphenyl)carbamoyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(=O)Nc2ccc(OC)c(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C15H20N4O5/c1-23-12-4-3-10(9-11(12)13(16)20)17-14(21)18-5-7-19(8-6-18)15(22)24-2/h3-4,9H,5-8H2,1-2H3,(H2,16,20)(H,17,21) |
| InChIKey | UBWVCMIWVWPARR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |