About dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate
dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 12774286) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate.
Analyze dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The IUPAC name of dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate (CID 12774286) is dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate.
What is the SMILES notation for dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The canonical SMILES for dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate is COC(=O)[C@@H]1CC2(C[C@H]1C(=O)OC)OCCO2.
What is the InChIKey of dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The InChIKey is GYIKGEVWDJACLQ-HTQZYQBOSA-N. The full InChI is InChI=1S/C11H16O6/c1-14-9(12)7-5-11(16-3-4-17-11)6-8(7)10(13)15-2/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate has a molecular weight of 244.24 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (7R,8R)-1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate is sourced from PubChem (CID 12774286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).