C10H16O6 — CID 24813509
(1R,2R,4S)-2-methoxycarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylic acid (PubChem CID 24813509) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (1R,2R,4S)-2-methoxycarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,4S)-2-methoxycarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 24813509 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (1R,2R,4S)-2-methoxycarbonyl-4-(methoxymethoxy)cyclopentane-1-carboxylic acid |
| SMILES | COCO[C@H]1C[C@@H](C(=O)O)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C10H16O6/c1-14-5-16-6-3-7(9(11)12)8(4-6)10(13)15-2/h6-8H,3-5H2,1-2H3,(H,11,12)/t6-,7+,8+/m0/s1 |
| InChIKey | LROVKSPUZVTROT-XLPZGREQSA-N |
| XLogP | 0.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|