C12H22O5 — CID 102320023
methyl (1S,2R,3S,5R)-5-(2,2-dimethoxyethyl)-3-hydroxy-2-methylcyclopentane-1-carboxylate (PubChem CID 102320023) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is methyl (1S,2R,3S,5R)-5-(2,2-dimethoxyethyl)-3-hydroxy-2-methylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S,5R)-5-(2,2-dimethoxyethyl)-3-hydroxy-2-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102320023 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | methyl (1S,2R,3S,5R)-5-(2,2-dimethoxyethyl)-3-hydroxy-2-methylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](CC(OC)OC)C[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C12H22O5/c1-7-9(13)5-8(6-10(15-2)16-3)11(7)12(14)17-4/h7-11,13H,5-6H2,1-4H3/t7-,8+,9-,11+/m0/s1 |
| InChIKey | VOJUAOYOJWRPRR-QCBRBAQYSA-N |
| XLogP | 0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|