C9H14O6 — CID 135037953
trans-(1R,2R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylic acid (PubChem CID 135037953) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is trans-(1R,2R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylic acid.
| Compound Name | trans-(1R,2R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 135037953 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | trans-(1R,2R)-4-(methoxymethoxy)cyclopentane-1,2-dicarboxylic acid |
| SMILES | COCOC1C[C@@H](C(=O)O)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C9H14O6/c1-14-4-15-5-2-6(8(10)11)7(3-5)9(12)13/h5-7H,2-4H2,1H3,(H,10,11)(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | AOAIPRJBTWVDII-RNFRBKRXSA-N |
| XLogP | 0.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|