diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate

C13H20O6 — CID 588504

IUPACdiethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate
SMILESCCOC(=O)C1CC2(CC1C(=O)OCC)OCCO2
InChIInChI=1S/C13H20O6/c1-3-16-11(14)9-7-13(18-5-6-19-13)8-10(9)12(15)17-4-2/h9-10H,3-8H2,1-2H3
InChIKeyXGKMBUDTEYVUFW-UHFFFAOYSA-N
MW272.30 g/mol
LogP0.88
Rot. Bonds4

About diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate

diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 588504) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate.

Molecular Properties

Compound Namediethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate
PubChem CID588504
Molecular FormulaC13H20O6
Molecular Weight272.30 g/mol
Exact Mass272.13
IUPAC Namediethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate
SMILESCCOC(=O)C1CC2(CC1C(=O)OCC)OCCO2
InChIInChI=1S/C13H20O6/c1-3-16-11(14)9-7-13(18-5-6-19-13)8-10(9)12(15)17-4-2/h9-10H,3-8H2,1-2H3
InChIKeyXGKMBUDTEYVUFW-UHFFFAOYSA-N
XLogP0.88
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.30
LogP ≤ 50.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The IUPAC name of diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate (CID 588504) is diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate.
What is the SMILES notation for diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The canonical SMILES for diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate is CCOC(=O)C1CC2(CC1C(=O)OCC)OCCO2.
What is the InChIKey of diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
The InChIKey is XGKMBUDTEYVUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O6/c1-3-16-11(14)9-7-13(18-5-6-19-13)8-10(9)12(15)17-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate?
diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate has a molecular weight of 272.30 g/mol, XLogP of 0.88, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate is sourced from PubChem (CID 588504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).