C13H20O6 — CID 588504
diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate (PubChem CID 588504) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate.
| Compound Name | diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate |
|---|---|
| PubChem CID | 588504 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | diethyl 1,4-dioxaspiro[4.4]nonane-7,8-dicarboxylate |
| SMILES | CCOC(=O)C1CC2(CC1C(=O)OCC)OCCO2 |
| InChI | InChI=1S/C13H20O6/c1-3-16-11(14)9-7-13(18-5-6-19-13)8-10(9)12(15)17-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | XGKMBUDTEYVUFW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |