C13H19N3O2S — CID 127747471
2-(methoxymethyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 127747471) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(methoxymethyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 127747471 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-(methoxymethyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCc1nc(C(=O)NCC2=CCN(C)CC2)cs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-16-5-3-10(4-6-16)7-14-13(17)11-9-19-12(15-11)8-18-2/h3,9H,4-8H2,1-2H3,(H,14,17) |
| InChIKey | PQGRYUUNVZWENG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|