C16H22O11 — CID 12775391
methyl (2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-carboxylate (PubChem CID 12775391) has the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. Its IUPAC name is methyl (2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 12775391 |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl (2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O11/c1-7(17)23-6-11-12(24-8(2)18)13(25-9(3)19)14(26-10(4)20)15(27-11)16(21)22-5/h11-15H,6H2,1-5H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | VHTGJRGUFIUBLE-UXXRCYHCSA-N |
| XLogP | -0.71 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|